C18H25BO3 — CID 165392437
[(9S,14S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 165392437) has the molecular formula C18H25BO3 and a molecular weight of 300.21 g/mol. Its IUPAC name is [(9S,14S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(9S,14S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 165392437 |
| Molecular Formula | C18H25BO3 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | [(9S,14S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | CC12CC[C@@H]3c4ccc(B(O)O)cc4CCC3[C@@H]1CCC2O |
| InChI | InChI=1S/C18H25BO3/c1-18-9-8-14-13-5-3-12(19(21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,20-22H,2,4,6-9H2,1H3/t14-,15?,16+,17?,18?/m1/s1 |
| InChIKey | GNTONEVXWLHTKJ-XXQSONRNSA-N |
| XLogP | 1.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|