C18H26N2O8 — CID 87460830
(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;bis(nitric acid) (PubChem CID 87460830) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;bis(nitric acid).
| Compound Name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;bis(nitric acid) |
|---|---|
| PubChem CID | 87460830 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol;bis(nitric acid) |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C18H24O2.2HNO3/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;2*2-1(3)4/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;2*(H,2,3,4)/t14-,15-,16+,17+,18+;;/m1../s1 |
| InChIKey | ZZVMAOHPDUTJPH-LBARCDFESA-N |
| XLogP | 2.91 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|