C26H34O5 — CID 175107375
benzoic acid;methanol;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 175107375) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is benzoic acid;methanol;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | benzoic acid;methanol;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 175107375 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | benzoic acid;methanol;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CO.C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C18H24O2.C7H6O2.CH4O/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;8-7(9)6-4-2-1-3-5-6;1-2/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;1-5H,(H,8,9);2H,1H3/t14-,15-,16+,17+,18+;;/m1../s1 |
| InChIKey | ZXCLLRURAAZDEN-LBARCDFESA-N |
| XLogP | 4.60 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |