C25H28O3 — CID 174953282
[(8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl]-phenylmethanone (PubChem CID 174953282) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl]-phenylmethanone.
| Compound Name | [(8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 174953282 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl]-phenylmethanone |
| SMILES | C[C@]12CC[C@@H]3c4c(cc(O)cc4C(=O)c4ccccc4)CC[C@H]3[C@@H]1CC[C@H]2O |
| InChI | InChI=1S/C25H28O3/c1-25-12-11-19-18(21(25)9-10-22(25)27)8-7-16-13-17(26)14-20(23(16)19)24(28)15-5-3-2-4-6-15/h2-6,13-14,18-19,21-22,26-27H,7-12H2,1H3/t18-,19+,21+,22-,25+/m1/s1 |
| InChIKey | OUFKGLFPOWAZKB-ITHABSICSA-N |
| XLogP | 4.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |