C27H34O6 — CID 170337830
acetic acid;benzoic acid;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 170337830) has the molecular formula C27H34O6 and a molecular weight of 454.56 g/mol. Its IUPAC name is acetic acid;benzoic acid;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | acetic acid;benzoic acid;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 170337830 |
| Molecular Formula | C27H34O6 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | acetic acid;benzoic acid;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC(=O)O.C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C18H24O2.C7H6O2.C2H4O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;8-7(9)6-4-2-1-3-5-6;1-2(3)4/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;1-5H,(H,8,9);1H3,(H,3,4)/t14-,15-,16+,17+,18+;;/m1../s1 |
| InChIKey | UKSRKBDVILNLKM-LBARCDFESA-N |
| XLogP | 5.08 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |