C23H26ClF2NO2 — CID 135357460
4-chloro-3,5-difluoropyridine;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 135357460) has the molecular formula C23H26ClF2NO2 and a molecular weight of 421.92 g/mol. Its IUPAC name is 4-chloro-3,5-difluoropyridine;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | 4-chloro-3,5-difluoropyridine;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 135357460 |
| Molecular Formula | C23H26ClF2NO2 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-chloro-3,5-difluoropyridine;(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O.Fc1cncc(F)c1Cl |
| InChI | InChI=1S/C18H24O2.C5H2ClF2N/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;6-5-3(7)1-9-2-4(5)8/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;1-2H/t14-,15-,16+,17+,18+;/m1./s1 |
| InChIKey | RVFGRCRKQLLHPW-CMZLOHJFSA-N |
| XLogP | 5.62 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |