C25H36O5 — CID 161171424
cyclohexyl hydrogen carbonate;(8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 161171424) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is cyclohexyl hydrogen carbonate;(8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | cyclohexyl hydrogen carbonate;(8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 161171424 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | cyclohexyl hydrogen carbonate;(8R,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CCC2O.O=C(O)OC1CCCCC1 |
| InChI | InChI=1S/C18H24O2.C7H12O3/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;8-7(9)10-6-4-2-1-3-5-6/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;6H,1-5H2,(H,8,9)/t14-,15-,16+,17?,18+;/m1./s1 |
| InChIKey | URFOTBVJPFXDRA-WAJSLEGFSA-N |
| XLogP | 5.62 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |