C34H57NO3 — CID 142302247
N-butyl-N-methylundecanamide;13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 142302247) has the molecular formula C34H57NO3 and a molecular weight of 527.83 g/mol. Its IUPAC name is N-butyl-N-methylundecanamide;13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | N-butyl-N-methylundecanamide;13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 142302247 |
| Molecular Formula | C34H57NO3 |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 527.43 |
| IUPAC Name | N-butyl-N-methylundecanamide;13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC12CCC3c4ccc(O)cc4CCC3C1CCC2O.CCCCCCCCCCC(=O)N(C)CCCC |
| InChI | InChI=1S/C18H24O2.C16H33NO/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;1-4-6-8-9-10-11-12-13-14-16(18)17(3)15-7-5-2/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;4-15H2,1-3H3 |
| InChIKey | KAQOCJZFYGNDGC-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|