C31H49NO3 — CID 10458007
N-butyl-8-[(8R,9S,13S,14S,15S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-N-methyloctanamide (PubChem CID 10458007) has the molecular formula C31H49NO3 and a molecular weight of 483.74 g/mol. Its IUPAC name is N-butyl-8-[(8R,9S,13S,14S,15S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-N-methyloctanamide.
| Compound Name | N-butyl-8-[(8R,9S,13S,14S,15S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-N-methyloctanamide |
|---|---|
| PubChem CID | 10458007 |
| Molecular Formula | C31H49NO3 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | N-butyl-8-[(8R,9S,13S,14S,15S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-N-methyloctanamide |
| SMILES | CCCCN(C)C(=O)CCCCCCC[C@H]1C[C@H](O)[C@@]2(C)CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C31H49NO3/c1-4-5-19-32(3)29(35)12-10-8-6-7-9-11-23-21-28(34)31(2)18-17-26-25-16-14-24(33)20-22(25)13-15-27(26)30(23)31/h14,16,20,23,26-28,30,33-34H,4-13,15,17-19,21H2,1-3H3/t23-,26+,27+,28-,30-,31+/m0/s1 |
| InChIKey | MMYQCEGQDICRNQ-YRMALKRESA-N |
| XLogP | 6.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|