C33H52BrNO3 — CID 10579300
7-(bromomethyl)-N-butyl-9-[(8R,9S,13S,14S,16R,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-N-methylnonanamide (PubChem CID 10579300) has the molecular formula C33H52BrNO3 and a molecular weight of 590.69 g/mol. Its IUPAC name is 7-(bromomethyl)-N-butyl-9-[(8R,9S,13S,14S,16R,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-N-methylnonanamide.
| Compound Name | 7-(bromomethyl)-N-butyl-9-[(8R,9S,13S,14S,16R,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-N-methylnonanamide |
|---|---|
| PubChem CID | 10579300 |
| Molecular Formula | C33H52BrNO3 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | 7-(bromomethyl)-N-butyl-9-[(8R,9S,13S,14S,16R,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-N-methylnonanamide |
| SMILES | CCCCN(C)C(=O)CCCCCC(CBr)CC[C@@H]1C[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C33H52BrNO3/c1-4-5-19-35(3)31(37)10-8-6-7-9-23(22-34)11-12-25-21-30-29-15-13-24-20-26(36)14-16-27(24)28(29)17-18-33(30,2)32(25)38/h14,16,20,23,25,28-30,32,36,38H,4-13,15,17-19,21-22H2,1-3H3/t23?,25-,28-,29-,30+,32+,33+/m1/s1 |
| InChIKey | DFVOUTYRTRKAHP-ACHOKQDOSA-N |
| XLogP | 7.84 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|