C24H34O4 — CID 126714199
methyl 4-[(13S,15R,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]butanoate (PubChem CID 126714199) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is methyl 4-[(13S,15R,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]butanoate.
| Compound Name | methyl 4-[(13S,15R,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]butanoate |
|---|---|
| PubChem CID | 126714199 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | methyl 4-[(13S,15R,17S)-17-hydroxy-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]butanoate |
| SMILES | COC(=O)CCCC1C[C@H](O)[C@@]2(C)CCC3c4ccc(OC)cc4CCC3C12 |
| InChI | InChI=1S/C24H34O4/c1-24-12-11-19-18-10-8-17(27-2)13-15(18)7-9-20(19)23(24)16(14-21(24)25)5-4-6-22(26)28-3/h8,10,13,16,19-21,23,25H,4-7,9,11-12,14H2,1-3H3/t16?,19?,20?,21-,23?,24+/m0/s1 |
| InChIKey | ABMHTNQNCRBSKA-OKJXKELUSA-N |
| XLogP | 4.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |