C20H26O2 — CID 70991557
(3R)-14-methoxy-7-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),12,14-trien-6-ol (PubChem CID 70991557) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (3R)-14-methoxy-7-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),12,14-trien-6-ol.
| Compound Name | (3R)-14-methoxy-7-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),12,14-trien-6-ol |
|---|---|
| PubChem CID | 70991557 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (3R)-14-methoxy-7-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),12,14-trien-6-ol |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(O)C3C[C@@H]3C12 |
| InChI | InChI=1S/C20H26O2/c1-20-8-7-14-13-6-4-12(22-2)9-11(13)3-5-15(14)18(20)16-10-17(16)19(20)21/h4,6,9,14-19,21H,3,5,7-8,10H2,1-2H3/t14?,15?,16-,17?,18?,19?,20?/m0/s1 |
| InChIKey | LOIQPWQBCHSATR-UAEINJCCSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |