C22H28O3 — CID 67686537
1-[(1R,2R,3S,5S,6R,7S,10S)-6-hydroxy-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),12,14-trienyl]ethanone (PubChem CID 67686537) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 1-[(1R,2R,3S,5S,6R,7S,10S)-6-hydroxy-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),12,14-trienyl]ethanone.
| Compound Name | 1-[(1R,2R,3S,5S,6R,7S,10S)-6-hydroxy-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),12,14-trienyl]ethanone |
|---|---|
| PubChem CID | 67686537 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-[(1R,2R,3S,5S,6R,7S,10S)-6-hydroxy-14-methoxy-7-methyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),12,14-trienyl]ethanone |
| SMILES | COc1ccc2c(c1)CC[C@H]1[C@@H]3[C@@H]4C[C@@H]4[C@](O)(C(C)=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C22H28O3/c1-12(23)22(24)19-11-18(19)20-17-6-4-13-10-14(25-3)5-7-15(13)16(17)8-9-21(20,22)2/h5,7,10,16-20,24H,4,6,8-9,11H2,1-3H3/t16-,17-,18-,19+,20-,21+,22-/m1/s1 |
| InChIKey | RFEHKZMMHLNLQP-NLTCRUIOSA-N |
| XLogP | 3.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |