C28H40O4 — CID 66623821
propan-2-yl 6-[(8R,9S,13S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]hexanoate (PubChem CID 66623821) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is propan-2-yl 6-[(8R,9S,13S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]hexanoate.
| Compound Name | propan-2-yl 6-[(8R,9S,13S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]hexanoate |
|---|---|
| PubChem CID | 66623821 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | propan-2-yl 6-[(8R,9S,13S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]hexanoate |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC(CCCCCC(=O)OC(C)C)[C@@H]12 |
| InChI | InChI=1S/C28H40O4/c1-18(2)32-26(30)9-7-5-6-8-20-17-25(29)28(3)15-14-23-22-13-11-21(31-4)16-19(22)10-12-24(23)27(20)28/h11,13,16,18,20,23-24,27H,5-10,12,14-15,17H2,1-4H3/t20?,23-,24-,27+,28-/m1/s1 |
| InChIKey | HXBOQTWECMRSCY-SBLWTFOCSA-N |
| XLogP | 6.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|