C29H41NO3 — CID 143047614
N-cyclohexyl-3-[(9S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-methylpropanamide (PubChem CID 143047614) has the molecular formula C29H41NO3 and a molecular weight of 451.65 g/mol. Its IUPAC name is N-cyclohexyl-3-[(9S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-methylpropanamide.
| Compound Name | N-cyclohexyl-3-[(9S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 143047614 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | N-cyclohexyl-3-[(9S,14S)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-methylpropanamide |
| SMILES | COc1ccc2c(c1)CCC1[C@@H]3C(CCC(=O)N(C)C4CCCCC4)CC(=O)C3(C)CC[C@H]21 |
| InChI | InChI=1S/C29H41NO3/c1-29-16-15-24-23-13-11-22(33-3)17-19(23)9-12-25(24)28(29)20(18-26(29)31)10-14-27(32)30(2)21-7-5-4-6-8-21/h11,13,17,20-21,24-25,28H,4-10,12,14-16,18H2,1-3H3/t20?,24-,25?,28+,29?/m1/s1 |
| InChIKey | ICGNGQQYGHOLAD-RGQVSHQHSA-N |
| XLogP | 5.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |