C25H36BNO4 — CID 69231960
[(8R,9S,13S,14S,15R)-15-[3-(diethylamino)-3-oxopropyl]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 69231960) has the molecular formula C25H36BNO4 and a molecular weight of 425.38 g/mol. Its IUPAC name is [(8R,9S,13S,14S,15R)-15-[3-(diethylamino)-3-oxopropyl]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(8R,9S,13S,14S,15R)-15-[3-(diethylamino)-3-oxopropyl]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 69231960 |
| Molecular Formula | C25H36BNO4 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | [(8R,9S,13S,14S,15R)-15-[3-(diethylamino)-3-oxopropyl]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | CCN(CC)C(=O)CC[C@@H]1CC(=O)[C@@]2(C)CC[C@@H]3c4ccc(B(O)O)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H36BNO4/c1-4-27(5-2)23(29)11-7-17-15-22(28)25(3)13-12-20-19-10-8-18(26(30)31)14-16(19)6-9-21(20)24(17)25/h8,10,14,17,20-21,24,30-31H,4-7,9,11-13,15H2,1-3H3/t17-,20-,21-,24+,25-/m1/s1 |
| InChIKey | FFRXKSAKHOVVKD-WVJYQVJNSA-N |
| XLogP | 2.67 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|