C31H38O4 — CID 66624083
ethyl 4-[(8R,9S,13S,14S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoate (PubChem CID 66624083) has the molecular formula C31H38O4 and a molecular weight of 474.64 g/mol. Its IUPAC name is ethyl 4-[(8R,9S,13S,14S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoate.
| Compound Name | ethyl 4-[(8R,9S,13S,14S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoate |
|---|---|
| PubChem CID | 66624083 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | ethyl 4-[(8R,9S,13S,14S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoate |
| SMILES | CCOC(=O)CCCC1CC(=O)[C@@]2(C)CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C31H38O4/c1-3-34-29(33)11-7-10-23-19-28(32)31(2)17-16-26-25-15-13-24(35-20-21-8-5-4-6-9-21)18-22(25)12-14-27(26)30(23)31/h4-6,8-9,13,15,18,23,26-27,30H,3,7,10-12,14,16-17,19-20H2,1-2H3/t23?,26-,27-,30+,31-/m1/s1 |
| InChIKey | BNCJSGVBSJBLTH-ZIVPYHHZSA-N |
| XLogP | 6.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |