C30H33F3O3 — CID 140560703
4-[(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]butanoic acid (PubChem CID 140560703) has the molecular formula C30H33F3O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 4-[(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]butanoic acid.
| Compound Name | 4-[(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]butanoic acid |
|---|---|
| PubChem CID | 140560703 |
| Molecular Formula | C30H33F3O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 4-[(8R,9S,13S,14S)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-15-yl]butanoic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1C(CCCC(=O)O)C=C2C(F)(F)F |
| InChI | InChI=1S/C30H33F3O3/c1-29-15-14-24-23-13-11-22(36-18-19-6-3-2-4-7-19)16-20(23)10-12-25(24)28(29)21(8-5-9-27(34)35)17-26(29)30(31,32)33/h2-4,6-7,11,13,16-17,21,24-25,28H,5,8-10,12,14-15,18H2,1H3,(H,34,35)/t21?,24-,25-,28+,29-/m1/s1 |
| InChIKey | KADXYZSKUOWZDL-MKBDELAZSA-N |
| XLogP | 7.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|