C35H45F3O4 — CID 66859795
4-[(8R,9S,13S,14S)-17-hydroxy-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butyl 2,2-dimethylpropanoate (PubChem CID 66859795) has the molecular formula C35H45F3O4 and a molecular weight of 586.74 g/mol. Its IUPAC name is 4-[(8R,9S,13S,14S)-17-hydroxy-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butyl 2,2-dimethylpropanoate.
| Compound Name | 4-[(8R,9S,13S,14S)-17-hydroxy-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 66859795 |
| Molecular Formula | C35H45F3O4 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 4-[(8R,9S,13S,14S)-17-hydroxy-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCCCC1CC(O)(C(F)(F)F)[C@@]2(C)CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C35H45F3O4/c1-32(2,3)31(39)41-19-9-8-12-25-21-34(40,35(36,37)38)33(4)18-17-28-27-16-14-26(42-22-23-10-6-5-7-11-23)20-24(27)13-15-29(28)30(25)33/h5-7,10-11,14,16,20,25,28-30,40H,8-9,12-13,15,17-19,21-22H2,1-4H3/t25?,28-,29-,30+,33+,34?/m1/s1 |
| InChIKey | MKLHGEHVRYMZGK-CZCLIQKWSA-N |
| XLogP | 8.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|