C32H52O4 — CID 143047610
ethane;4-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)butyl 2,2-dimethylpropanoate (PubChem CID 143047610) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is ethane;4-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)butyl 2,2-dimethylpropanoate.
| Compound Name | ethane;4-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)butyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 143047610 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | ethane;4-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)butyl 2,2-dimethylpropanoate |
| SMILES | CC.CC.COc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CC(CCCCOC(=O)C(C)(C)C)C12 |
| InChI | InChI=1S/C28H40O4.2C2H6/c1-27(2,3)26(30)32-15-7-6-8-19-17-24(29)28(4)14-13-22-21-12-10-20(31-5)16-18(21)9-11-23(22)25(19)28;2*1-2/h10,12,16,19,22-23,25H,6-9,11,13-15,17H2,1-5H3;2*1-2H3 |
| InChIKey | LYPDCFZLDICWEA-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|