C31H40N2O3 — CID 66623755
1-benzyl-3-[4-[(13S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butyl]urea (PubChem CID 66623755) has the molecular formula C31H40N2O3 and a molecular weight of 488.67 g/mol. Its IUPAC name is 1-benzyl-3-[4-[(13S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butyl]urea.
| Compound Name | 1-benzyl-3-[4-[(13S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butyl]urea |
|---|---|
| PubChem CID | 66623755 |
| Molecular Formula | C31H40N2O3 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 1-benzyl-3-[4-[(13S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butyl]urea |
| SMILES | COc1ccc2c(c1)CCC1C2CC[C@]2(C)C(=O)CC(CCCCNC(=O)NCc3ccccc3)C12 |
| InChI | InChI=1S/C31H40N2O3/c1-31-16-15-26-25-14-12-24(36-2)18-22(25)11-13-27(26)29(31)23(19-28(31)34)10-6-7-17-32-30(35)33-20-21-8-4-3-5-9-21/h3-5,8-9,12,14,18,23,26-27,29H,6-7,10-11,13,15-17,19-20H2,1-2H3,(H2,32,33,35)/t23?,26?,27?,29?,31-/m1/s1 |
| InChIKey | JXYZXZFMVFFGDZ-RYVJCWNXSA-N |
| XLogP | 6.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|