C32H41NO4 — CID 11432089
N-[(4-hydroxyphenyl)methyl]-6-[(8R,9S,13S,14S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]hexanamide (PubChem CID 11432089) has the molecular formula C32H41NO4 and a molecular weight of 503.68 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)methyl]-6-[(8R,9S,13S,14S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]hexanamide.
| Compound Name | N-[(4-hydroxyphenyl)methyl]-6-[(8R,9S,13S,14S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]hexanamide |
|---|---|
| PubChem CID | 11432089 |
| Molecular Formula | C32H41NO4 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | N-[(4-hydroxyphenyl)methyl]-6-[(8R,9S,13S,14S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]hexanamide |
| SMILES | COc1ccc2c(c1)CC[C@H]1[C@@H]3[C@H](CCCCCC(=O)NCc4ccc(O)cc4)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C32H41NO4/c1-32-17-16-27-26-15-13-25(37-2)18-22(26)10-14-28(27)31(32)23(19-29(32)35)6-4-3-5-7-30(36)33-20-21-8-11-24(34)12-9-21/h8-9,11-13,15,18,23,27-28,31,34H,3-7,10,14,16-17,19-20H2,1-2H3,(H,33,36)/t23-,27-,28-,31+,32-/m1/s1 |
| InChIKey | QCYZVGWFEFUFPX-TYVLPFHYSA-N |
| XLogP | 6.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|