C30H37NO4 — CID 15950278
N-benzyl-4-[(8R,9S,13S,14S,15S)-3-hydroxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide (PubChem CID 15950278) has the molecular formula C30H37NO4 and a molecular weight of 475.63 g/mol. Its IUPAC name is N-benzyl-4-[(8R,9S,13S,14S,15S)-3-hydroxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide.
| Compound Name | N-benzyl-4-[(8R,9S,13S,14S,15S)-3-hydroxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide |
|---|---|
| PubChem CID | 15950278 |
| Molecular Formula | C30H37NO4 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-benzyl-4-[(8R,9S,13S,14S,15S)-3-hydroxy-2-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide |
| SMILES | COc1cc2c(cc1O)CC[C@H]1[C@@H]3[C@@H](CCCC(=O)NCc4ccccc4)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C30H37NO4/c1-30-14-13-22-23(12-11-20-15-25(32)26(35-2)17-24(20)22)29(30)21(16-27(30)33)9-6-10-28(34)31-18-19-7-4-3-5-8-19/h3-5,7-8,15,17,21-23,29,32H,6,9-14,16,18H2,1-2H3,(H,31,34)/t21-,22-,23+,29-,30+/m0/s1 |
| InChIKey | KMZQTBXAMCNYAN-SIBSHHCZSA-N |
| XLogP | 5.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |