C25H34O5 — CID 66859868
methyl 4-[(8R,9S,13S,14S,15S)-2-ethoxy-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoate (PubChem CID 66859868) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is methyl 4-[(8R,9S,13S,14S,15S)-2-ethoxy-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoate.
| Compound Name | methyl 4-[(8R,9S,13S,14S,15S)-2-ethoxy-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoate |
|---|---|
| PubChem CID | 66859868 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | methyl 4-[(8R,9S,13S,14S,15S)-2-ethoxy-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoate |
| SMILES | CCOc1cc2c(cc1O)CC[C@H]1[C@@H]3[C@@H](CCCC(=O)OC)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C25H34O5/c1-4-30-21-14-19-15(12-20(21)26)8-9-18-17(19)10-11-25(2)22(27)13-16(24(18)25)6-5-7-23(28)29-3/h12,14,16-18,24,26H,4-11,13H2,1-3H3/t16-,17-,18+,24-,25+/m0/s1 |
| InChIKey | BXPCJEBZXVFMPX-HSRATRFUSA-N |
| XLogP | 4.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |