C32H39NO6 — CID 15948913
N-(1,3-benzodioxol-5-ylmethyl)-4-[(8R,9S,13S,14S,15S)-2-ethoxy-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide (PubChem CID 15948913) has the molecular formula C32H39NO6 and a molecular weight of 533.67 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-[(8R,9S,13S,14S,15S)-2-ethoxy-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[(8R,9S,13S,14S,15S)-2-ethoxy-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide |
|---|---|
| PubChem CID | 15948913 |
| Molecular Formula | C32H39NO6 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[(8R,9S,13S,14S,15S)-2-ethoxy-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanamide |
| SMILES | CCOc1cc2c(cc1O)CC[C@H]1[C@@H]3[C@@H](CCCC(=O)NCc4ccc5c(c4)OCO5)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C32H39NO6/c1-3-37-27-16-24-20(14-25(27)34)8-9-23-22(24)11-12-32(2)29(35)15-21(31(23)32)5-4-6-30(36)33-17-19-7-10-26-28(13-19)39-18-38-26/h7,10,13-14,16,21-23,31,34H,3-6,8-9,11-12,15,17-18H2,1-2H3,(H,33,36)/t21-,22-,23+,31-,32+/m0/s1 |
| InChIKey | ZCMSGBOZHMDTAR-BDXVRUEPSA-N |
| XLogP | 5.66 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |