C34H42O5 — CID 58115443
(8R,9S,13S,14S,15R)-15-[6-(1,3-benzodioxol-5-yl)-4-oxohexyl]-3-hydroxy-13-methyl-2-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 58115443) has the molecular formula C34H42O5 and a molecular weight of 530.71 g/mol. Its IUPAC name is (8R,9S,13S,14S,15R)-15-[6-(1,3-benzodioxol-5-yl)-4-oxohexyl]-3-hydroxy-13-methyl-2-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,15R)-15-[6-(1,3-benzodioxol-5-yl)-4-oxohexyl]-3-hydroxy-13-methyl-2-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 58115443 |
| Molecular Formula | C34H42O5 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | (8R,9S,13S,14S,15R)-15-[6-(1,3-benzodioxol-5-yl)-4-oxohexyl]-3-hydroxy-13-methyl-2-propyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCCc1cc2c(cc1O)CC[C@H]1[C@@H]3[C@H](CCCC(=O)CCc4ccc5c(c4)OCO5)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C34H42O5/c1-3-5-23-17-28-22(18-29(23)36)10-12-27-26(28)14-15-34(2)32(37)19-24(33(27)34)6-4-7-25(35)11-8-21-9-13-30-31(16-21)39-20-38-30/h9,13,16-18,24,26-27,33,36H,3-8,10-12,14-15,19-20H2,1-2H3/t24-,26+,27-,33+,34-/m1/s1 |
| InChIKey | HYFOJMAIZWVVSJ-QUPVNTMMSA-N |
| XLogP | 7.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |