C30H36BF2NO5 — CID 69231188
[(8R,9S,13S,14S,15S)-15-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]-17,17-difluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 69231188) has the molecular formula C30H36BF2NO5 and a molecular weight of 539.43 g/mol. Its IUPAC name is [(8R,9S,13S,14S,15S)-15-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]-17,17-difluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(8R,9S,13S,14S,15S)-15-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]-17,17-difluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 69231188 |
| Molecular Formula | C30H36BF2NO5 |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | [(8R,9S,13S,14S,15S)-15-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]-17,17-difluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(B(O)O)cc4CC[C@H]3[C@@H]1[C@@H](CCCC(=O)NCc1ccc3c(c1)OCO3)CC2(F)F |
| InChI | InChI=1S/C30H36BF2NO5/c1-29-12-11-23-22-9-7-21(31(36)37)14-19(22)6-8-24(23)28(29)20(15-30(29,32)33)3-2-4-27(35)34-16-18-5-10-25-26(13-18)39-17-38-25/h5,7,9-10,13-14,20,23-24,28,36-37H,2-4,6,8,11-12,15-17H2,1H3,(H,34,35)/t20-,23+,24+,28-,29-/m0/s1 |
| InChIKey | HCADGASSLZWWKF-SBYWZXRTSA-N |
| XLogP | 4.30 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|