C30H37F2NO4 — CID 143335696
5-[(8R,9S,13S,14S)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]pentanamide (PubChem CID 143335696) has the molecular formula C30H37F2NO4 and a molecular weight of 513.63 g/mol. Its IUPAC name is 5-[(8R,9S,13S,14S)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]pentanamide.
| Compound Name | 5-[(8R,9S,13S,14S)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 143335696 |
| Molecular Formula | C30H37F2NO4 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 5-[(8R,9S,13S,14S)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-[(3,4-dihydroxyphenyl)methyl]pentanamide |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1C(CCCCC(=O)NCc1ccc(O)c(O)c1)CC2(F)F |
| InChI | InChI=1S/C30H37F2NO4/c1-29-13-12-23-22-10-8-21(34)15-19(22)7-9-24(23)28(29)20(16-30(29,31)32)4-2-3-5-27(37)33-17-18-6-11-25(35)26(36)14-18/h6,8,10-11,14-15,20,23-24,28,34-36H,2-5,7,9,12-13,16-17H2,1H3,(H,33,37)/t20?,23-,24-,28+,29+/m1/s1 |
| InChIKey | YURHDGLIMNBFFD-ABHWILBFSA-N |
| XLogP | 6.40 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|