C25H36BF2NO4 — CID 68807006
[(13S,15S)-17,17-difluoro-15-[4-(2-methoxyethylamino)-4-oxobutyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 68807006) has the molecular formula C25H36BF2NO4 and a molecular weight of 463.37 g/mol. Its IUPAC name is [(13S,15S)-17,17-difluoro-15-[4-(2-methoxyethylamino)-4-oxobutyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(13S,15S)-17,17-difluoro-15-[4-(2-methoxyethylamino)-4-oxobutyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 68807006 |
| Molecular Formula | C25H36BF2NO4 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | [(13S,15S)-17,17-difluoro-15-[4-(2-methoxyethylamino)-4-oxobutyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | COCCNC(=O)CCCC1CC(F)(F)[C@@]2(C)CCC3c4ccc(B(O)O)cc4CCC3C12 |
| InChI | InChI=1S/C25H36BF2NO4/c1-24-11-10-20-19-9-7-18(26(31)32)14-16(19)6-8-21(20)23(24)17(15-25(24,27)28)4-3-5-22(30)29-12-13-33-2/h7,9,14,17,20-21,23,31-32H,3-6,8,10-13,15H2,1-2H3,(H,29,30)/t17?,20?,21?,23?,24-/m0/s1 |
| InChIKey | CGTKAMHOGLZBQU-RTQPADPTSA-N |
| XLogP | 3.02 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|