C29H34BNO6 — CID 68806997
[(8R,9S,13S,14S,15S)-15-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutyl]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 68806997) has the molecular formula C29H34BNO6 and a molecular weight of 503.40 g/mol. Its IUPAC name is [(8R,9S,13S,14S,15S)-15-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutyl]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(8R,9S,13S,14S,15S)-15-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutyl]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 68806997 |
| Molecular Formula | C29H34BNO6 |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | [(8R,9S,13S,14S,15S)-15-[4-(1,3-benzodioxol-5-ylamino)-4-oxobutyl]-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(B(O)O)cc4CC[C@H]3[C@@H]1[C@@H](CCCC(=O)Nc1ccc3c(c1)OCO3)CC2=O |
| InChI | InChI=1S/C29H34BNO6/c1-29-12-11-22-21-9-6-19(30(34)35)13-17(21)5-8-23(22)28(29)18(14-26(29)32)3-2-4-27(33)31-20-7-10-24-25(15-20)37-16-36-24/h6-7,9-10,13,15,18,22-23,28,34-35H,2-5,8,11-12,14,16H2,1H3,(H,31,33)/t18-,22+,23+,28-,29+/m0/s1 |
| InChIKey | NLOSRKVUJHTATF-DBXCIHRKSA-N |
| XLogP | 3.56 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|