C28H30ClN3O2 — CID 154999181
4-[(13S,15R)-3-chloro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-cyano-2-pyridinyl)butanamide (PubChem CID 154999181) has the molecular formula C28H30ClN3O2 and a molecular weight of 476.02 g/mol. Its IUPAC name is 4-[(13S,15R)-3-chloro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-cyano-2-pyridinyl)butanamide.
| Compound Name | 4-[(13S,15R)-3-chloro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-cyano-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 154999181 |
| Molecular Formula | C28H30ClN3O2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-[(13S,15R)-3-chloro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-cyano-2-pyridinyl)butanamide |
| SMILES | C[C@]12CCC3c4ccc(Cl)cc4CCC3C1C(CCCC(=O)Nc1ccc(C#N)cn1)CC2=O |
| InChI | InChI=1S/C28H30ClN3O2/c1-28-12-11-22-21-9-7-20(29)13-18(21)6-8-23(22)27(28)19(14-24(28)33)3-2-4-26(34)32-25-10-5-17(15-30)16-31-25/h5,7,9-10,13,16,19,22-23,27H,2-4,6,8,11-12,14H2,1H3,(H,31,32,34)/t19?,22?,23?,27?,28-/m1/s1 |
| InChIKey | QUGUKSRJUNMDIV-VUNBVCEBSA-N |
| XLogP | 6.07 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |