C25H29ClN2O3S — CID 123599068
3-(2-chloro-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 123599068) has the molecular formula C25H29ClN2O3S and a molecular weight of 473.04 g/mol. Its IUPAC name is 3-(2-chloro-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(2-chloro-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 123599068 |
| Molecular Formula | C25H29ClN2O3S |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 3-(2-chloro-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)CCC2CC(=O)C3(C)CCC4c5cc(Cl)c(O)cc5CCC4C23)s1 |
| InChI | InChI=1S/C25H29ClN2O3S/c1-13-12-27-24(32-13)28-22(31)6-4-15-10-21(30)25(2)8-7-16-17(23(15)25)5-3-14-9-20(29)19(26)11-18(14)16/h9,11-12,15-17,23,29H,3-8,10H2,1-2H3,(H,27,28,31) |
| InChIKey | BBQLOFVXMLYYLX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |