C26H33N5O3S — CID 87055747
3-[(13S,15R,17E)-17-(carbamoylhydrazinylidene)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 87055747) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-17-(carbamoylhydrazinylidene)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(13S,15R,17E)-17-(carbamoylhydrazinylidene)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 87055747 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 3-[(13S,15R,17E)-17-(carbamoylhydrazinylidene)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)CCC2C/C(=N\NC(N)=O)[C@@]3(C)CCC4c5ccc(O)cc5CCC4C23)s1 |
| InChI | InChI=1S/C26H33N5O3S/c1-14-13-28-25(35-14)29-22(33)8-4-16-12-21(30-31-24(27)34)26(2)10-9-19-18-7-5-17(32)11-15(18)3-6-20(19)23(16)26/h5,7,11,13,16,19-20,23,32H,3-4,6,8-10,12H2,1-2H3,(H3,27,31,34)(H,28,29,33)/b30-21+/t16?,19?,20?,23?,26-/m1/s1 |
| InChIKey | MKIWDRSCDNCXLB-ZPOQWQLXSA-N |
| XLogP | 4.68 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|