C26H32N2O3S — CID 129073709
4-[(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 129073709) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 4-[(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-[(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 129073709 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[(8R,9S,13S,14S,15R)-3-hydroxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1cnc(NC(=O)CCC[C@@H]2CC(=O)[C@@]3(C)CC[C@@H]4c5ccc(O)cc5CC[C@H]4[C@H]23)s1 |
| InChI | InChI=1S/C26H32N2O3S/c1-15-14-27-25(32-15)28-23(31)5-3-4-17-13-22(30)26(2)11-10-20-19-9-7-18(29)12-16(19)6-8-21(20)24(17)26/h7,9,12,14,17,20-21,24,29H,3-6,8,10-11,13H2,1-2H3,(H,27,28,31)/t17-,20-,21-,24+,26-/m1/s1 |
| InChIKey | TZBUTDXVVJYRAU-RFZNLCKASA-N |
| XLogP | 5.62 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |