C28H33FN2O4S — CID 129073704
[(13S,15R)-4-fluoro-13-methyl-15-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 129073704) has the molecular formula C28H33FN2O4S and a molecular weight of 512.65 g/mol. Its IUPAC name is [(13S,15R)-4-fluoro-13-methyl-15-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(13S,15R)-4-fluoro-13-methyl-15-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 129073704 |
| Molecular Formula | C28H33FN2O4S |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | [(13S,15R)-4-fluoro-13-methyl-15-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1F)CCC1C2CC[C@]2(C)C(=O)CC(CCCC(=O)Nc3ncc(C)s3)C12 |
| InChI | InChI=1S/C28H33FN2O4S/c1-15-14-30-27(36-15)31-24(34)6-4-5-17-13-23(33)28(3)12-11-19-18-9-10-22(35-16(2)32)26(29)21(18)8-7-20(19)25(17)28/h9-10,14,17,19-20,25H,4-8,11-13H2,1-3H3,(H,30,31,34)/t17?,19?,20?,25?,28-/m1/s1 |
| InChIKey | MXCGUQVJPBHUFV-NFFVHCBSSA-N |
| XLogP | 5.98 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|