C26H31N3O7S2 — CID 90468340
[(13S,15R)-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-4-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]methanesulfonic acid (PubChem CID 90468340) has the molecular formula C26H31N3O7S2 and a molecular weight of 561.68 g/mol. Its IUPAC name is [(13S,15R)-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-4-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]methanesulfonic acid.
| Compound Name | [(13S,15R)-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-4-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 90468340 |
| Molecular Formula | C26H31N3O7S2 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | [(13S,15R)-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-4-nitro-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]methanesulfonic acid |
| SMILES | Cc1cnc(NC(=O)CCC2CC(=O)[C@@]3(C)CCC4c5ccc(CS(=O)(=O)O)c([N+](=O)[O-])c5CCC4C23)s1 |
| InChI | InChI=1S/C26H31N3O7S2/c1-14-12-27-25(37-14)28-22(31)8-4-15-11-21(30)26(2)10-9-18-17-5-3-16(13-38(34,35)36)24(29(32)33)20(17)7-6-19(18)23(15)26/h3,5,12,15,18-19,23H,4,6-11,13H2,1-2H3,(H,27,28,31)(H,34,35,36)/t15?,18?,19?,23?,26-/m1/s1 |
| InChIKey | XGDPYGSNZONFEN-ZLPJDNSYSA-N |
| XLogP | 4.82 |
| TPSA | 156.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|