C26H31N5O4S — CID 130316050
3-(16-hydroxy-9-methyl-17-nitro-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,13(18),14,16-tetraen-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 130316050) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is 3-(16-hydroxy-9-methyl-17-nitro-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,13(18),14,16-tetraen-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(16-hydroxy-9-methyl-17-nitro-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,13(18),14,16-tetraen-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 130316050 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 3-(16-hydroxy-9-methyl-17-nitro-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,13(18),14,16-tetraen-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)CCC2C3=CNNC3C3(C)CCC4c5ccc(O)c([N+](=O)[O-])c5CCC4C23)s1 |
| InChI | InChI=1S/C26H31N5O4S/c1-13-11-27-25(36-13)29-21(33)8-6-17-19-12-28-30-24(19)26(2)10-9-15-14-5-7-20(32)23(31(34)35)18(14)4-3-16(15)22(17)26/h5,7,11-12,15-17,22,24,28,30,32H,3-4,6,8-10H2,1-2H3,(H,27,29,33) |
| InChIKey | VLKQMBYUEGPULD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|