C27H34N4O2S — CID 130316048
3-(16-methoxy-9-methyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,13(18),14,16-tetraen-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 130316048) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is 3-(16-methoxy-9-methyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,13(18),14,16-tetraen-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(16-methoxy-9-methyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,13(18),14,16-tetraen-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 130316048 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 3-(16-methoxy-9-methyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,13(18),14,16-tetraen-3-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C3NNC=C3C(CCC(=O)Nc3ncc(C)s3)C12 |
| InChI | InChI=1S/C27H34N4O2S/c1-15-13-28-26(34-15)30-23(32)9-8-21-22-14-29-31-25(22)27(2)11-10-19-18-7-5-17(33-3)12-16(18)4-6-20(19)24(21)27/h5,7,12-14,19-21,24-25,29,31H,4,6,8-11H2,1-3H3,(H,28,30,32) |
| InChIKey | KCKNAVOTPKODNI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |