C31H42N2O4S — CID 126714193
4-[(13S,15R,17S)-17-hydroxy-13-methyl-3-(oxan-2-yloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 126714193) has the molecular formula C31H42N2O4S and a molecular weight of 538.75 g/mol. Its IUPAC name is 4-[(13S,15R,17S)-17-hydroxy-13-methyl-3-(oxan-2-yloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-[(13S,15R,17S)-17-hydroxy-13-methyl-3-(oxan-2-yloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 126714193 |
| Molecular Formula | C31H42N2O4S |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | 4-[(13S,15R,17S)-17-hydroxy-13-methyl-3-(oxan-2-yloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1cnc(NC(=O)CCCC2C[C@H](O)[C@@]3(C)CCC4c5ccc(OC6CCCCO6)cc5CCC4C23)s1 |
| InChI | InChI=1S/C31H42N2O4S/c1-19-18-32-30(38-19)33-27(35)7-5-6-21-17-26(34)31(2)14-13-24-23-12-10-22(37-28-8-3-4-15-36-28)16-20(23)9-11-25(24)29(21)31/h10,12,16,18,21,24-26,28-29,34H,3-9,11,13-15,17H2,1-2H3,(H,32,33,35)/t21?,24?,25?,26-,28?,29?,31+/m0/s1 |
| InChIKey | RKOMCEUDTGEJFB-PRAQHSCGSA-N |
| XLogP | 6.61 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |