C26H32N2O4S — CID 146512907
3-(16-hydroxy-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 146512907) has the molecular formula C26H32N2O4S and a molecular weight of 468.62 g/mol. Its IUPAC name is 3-(16-hydroxy-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(16-hydroxy-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 146512907 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 3-(16-hydroxy-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(=O)C(O)C(CCC(=O)Nc3ncc(C)s3)C12 |
| InChI | InChI=1S/C26H32N2O4S/c1-14-13-27-25(33-14)28-21(29)9-8-20-22-19-6-4-15-12-16(32-3)5-7-17(15)18(19)10-11-26(22,2)24(31)23(20)30/h5,7,12-13,18-20,22-23,30H,4,6,8-11H2,1-3H3,(H,27,28,29) |
| InChIKey | VKVVTCIFSSINDB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |