C26H34N2O3S — CID 139418054
3-[(13S,15R,17S)-3,17-dimethoxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 139418054) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 3-[(13S,15R,17S)-3,17-dimethoxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(13S,15R,17S)-3,17-dimethoxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 139418054 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 3-[(13S,15R,17S)-3,17-dimethoxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1ccc2c(c1)CCC1C2CC[C@H]2C1C(CCC(=O)Nc1ncc(C)s1)C[C@@H]2OC |
| InChI | InChI=1S/C26H34N2O3S/c1-15-14-27-26(32-15)28-24(29)11-5-17-13-23(31-3)22-10-9-20-19-8-6-18(30-2)12-16(19)4-7-21(20)25(17)22/h6,8,12,14,17,20-23,25H,4-5,7,9-11,13H2,1-3H3,(H,27,28,29)/t17?,20?,21?,22-,23+,25?/m1/s1 |
| InChIKey | RPIAGNRMLOMHHM-FLAARFIZSA-N |
| XLogP | 5.59 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |