C37H46N2O4S — CID 123622634
[13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate (PubChem CID 123622634) has the molecular formula C37H46N2O4S and a molecular weight of 614.85 g/mol. Its IUPAC name is [13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate.
| Compound Name | [13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
|---|---|
| PubChem CID | 123622634 |
| Molecular Formula | C37H46N2O4S |
| Molecular Weight | 614.85 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | [13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| SMILES | CCCCC(=O)OC1CC(CCC(=O)Nc2ncc(C)s2)C2C3CCc4cc(OCc5ccccc5)ccc4C3CCC12C |
| InChI | InChI=1S/C37H46N2O4S/c1-4-5-11-34(41)43-32-21-27(13-17-33(40)39-36-38-22-24(2)44-36)35-31-15-12-26-20-28(42-23-25-9-7-6-8-10-25)14-16-29(26)30(31)18-19-37(32,35)3/h6-10,14,16,20,22,27,30-32,35H,4-5,11-13,15,17-19,21,23H2,1-3H3,(H,38,39,40) |
| InChIKey | NLGKYIZOIKOFDY-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.85 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |