C27H36N2O6S2 — CID 153320733
[(13S,15R,17S)-17-hydroxy-3-methoxy-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] methanesulfonate (PubChem CID 153320733) has the molecular formula C27H36N2O6S2 and a molecular weight of 548.73 g/mol. Its IUPAC name is [(13S,15R,17S)-17-hydroxy-3-methoxy-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] methanesulfonate.
| Compound Name | [(13S,15R,17S)-17-hydroxy-3-methoxy-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] methanesulfonate |
|---|---|
| PubChem CID | 153320733 |
| Molecular Formula | C27H36N2O6S2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | [(13S,15R,17S)-17-hydroxy-3-methoxy-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] methanesulfonate |
| SMILES | COc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1C(CCC(=O)Nc1ncc(C)s1)C[C@]2(O)OS(C)(=O)=O |
| InChI | InChI=1S/C27H36N2O6S2/c1-16-15-28-25(36-16)29-23(30)10-6-18-14-27(31,35-37(4,32)33)26(2)12-11-21-20-9-7-19(34-3)13-17(20)5-8-22(21)24(18)26/h7,9,13,15,18,21-22,24,31H,5-6,8,10-12,14H2,1-4H3,(H,28,29,30)/t18?,21?,22?,24?,26-,27-/m0/s1 |
| InChIKey | XMTGMCBKRKAVPY-CZGFWCNGSA-N |
| XLogP | 4.63 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|