C25H31BF2N2O3S — CID 143681779
[(9S,13S,14S)-17,17-difluoro-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 143681779) has the molecular formula C25H31BF2N2O3S and a molecular weight of 488.41 g/mol. Its IUPAC name is [(9S,13S,14S)-17,17-difluoro-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(9S,13S,14S)-17,17-difluoro-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 143681779 |
| Molecular Formula | C25H31BF2N2O3S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | [(9S,13S,14S)-17,17-difluoro-13-methyl-15-[3-[(5-methyl-1,3-thiazol-2-yl)amino]-3-oxopropyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | Cc1cnc(NC(=O)CCC2CC(F)(F)[C@@]3(C)CC[C@@H]4c5ccc(B(O)O)cc5CCC4[C@H]23)s1 |
| InChI | InChI=1S/C25H31BF2N2O3S/c1-14-13-29-23(34-14)30-21(31)8-4-16-12-25(27,28)24(2)10-9-19-18-7-5-17(26(32)33)11-15(18)3-6-20(19)22(16)24/h5,7,11,13,16,19-20,22,32-33H,3-4,6,8-10,12H2,1-2H3,(H,29,30,31)/t16?,19-,20?,22+,24+/m1/s1 |
| InChIKey | ZBAMVIRSRFITJK-KQOBYEJASA-N |
| XLogP | 4.27 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|