C28H40BF2NO3 — CID 68806210
[(8R,9S,13S,14S,15S)-15-[4-(cyclohexylamino)-4-oxobutyl]-17,17-difluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid (PubChem CID 68806210) has the molecular formula C28H40BF2NO3 and a molecular weight of 487.44 g/mol. Its IUPAC name is [(8R,9S,13S,14S,15S)-15-[4-(cyclohexylamino)-4-oxobutyl]-17,17-difluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid.
| Compound Name | [(8R,9S,13S,14S,15S)-15-[4-(cyclohexylamino)-4-oxobutyl]-17,17-difluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
|---|---|
| PubChem CID | 68806210 |
| Molecular Formula | C28H40BF2NO3 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | [(8R,9S,13S,14S,15S)-15-[4-(cyclohexylamino)-4-oxobutyl]-17,17-difluoro-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]boronic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(B(O)O)cc4CC[C@H]3[C@@H]1[C@@H](CCCC(=O)NC1CCCCC1)CC2(F)F |
| InChI | InChI=1S/C28H40BF2NO3/c1-27-15-14-23-22-13-11-20(29(34)35)16-18(22)10-12-24(23)26(27)19(17-28(27,30)31)6-5-9-25(33)32-21-7-3-2-4-8-21/h11,13,16,19,21,23-24,26,34-35H,2-10,12,14-15,17H2,1H3,(H,32,33)/t19-,23+,24+,26-,27-/m0/s1 |
| InChIKey | KMMUZDIRIIMWKW-XRRKXFJESA-N |
| XLogP | 4.70 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|