C31H45NO3 — CID 143047625
N-cyclohexyl-5-(8-methoxy-12a-methyl-1-oxo-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-3-yl)pentanamide (PubChem CID 143047625) has the molecular formula C31H45NO3 and a molecular weight of 479.71 g/mol. Its IUPAC name is N-cyclohexyl-5-(8-methoxy-12a-methyl-1-oxo-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-3-yl)pentanamide.
| Compound Name | N-cyclohexyl-5-(8-methoxy-12a-methyl-1-oxo-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-3-yl)pentanamide |
|---|---|
| PubChem CID | 143047625 |
| Molecular Formula | C31H45NO3 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | N-cyclohexyl-5-(8-methoxy-12a-methyl-1-oxo-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-3-yl)pentanamide |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CC(CCCCC(=O)NC3CCCCC3)CC12 |
| InChI | InChI=1S/C31H45NO3/c1-31-17-16-26-25-15-13-24(35-2)20-22(25)12-14-27(26)28(31)18-21(19-29(31)33)8-6-7-11-30(34)32-23-9-4-3-5-10-23/h13,15,20-21,23,26-28H,3-12,14,16-19H2,1-2H3,(H,32,34) |
| InChIKey | RBOFQPKVULVVRV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|