C29H37NO4 — CID 11454039
N-(furan-2-ylmethyl)-5-[(8R,9S,13S,14S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]pentanamide (PubChem CID 11454039) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-[(8R,9S,13S,14S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]pentanamide.
| Compound Name | N-(furan-2-ylmethyl)-5-[(8R,9S,13S,14S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]pentanamide |
|---|---|
| PubChem CID | 11454039 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-[(8R,9S,13S,14S,15R)-3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]pentanamide |
| SMILES | COc1ccc2c(c1)CC[C@H]1[C@@H]3[C@H](CCCCC(=O)NCc4ccco4)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C29H37NO4/c1-29-14-13-24-23-12-10-21(33-2)16-19(23)9-11-25(24)28(29)20(17-26(29)31)6-3-4-8-27(32)30-18-22-7-5-15-34-22/h5,7,10,12,15-16,20,24-25,28H,3-4,6,8-9,11,13-14,17-18H2,1-2H3,(H,30,32)/t20-,24-,25-,28+,29-/m1/s1 |
| InChIKey | QDVUWTPANIDFIU-UPAYHNSLSA-N |
| XLogP | 5.82 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|