C29H34ClNO3 — CID 72627310
N-[(4-chlorophenyl)methyl]-3-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)propanamide (PubChem CID 72627310) has the molecular formula C29H34ClNO3 and a molecular weight of 480.05 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)propanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)propanamide |
|---|---|
| PubChem CID | 72627310 |
| Molecular Formula | C29H34ClNO3 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)propanamide |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CC(CCC(=O)NCc3ccc(Cl)cc3)C12 |
| InChI | InChI=1S/C29H34ClNO3/c1-29-14-13-24-23-11-9-22(34-2)15-19(23)5-10-25(24)28(29)20(16-26(29)32)6-12-27(33)31-17-18-3-7-21(30)8-4-18/h3-4,7-9,11,15,20,24-25,28H,5-6,10,12-14,16-17H2,1-2H3,(H,31,33) |
| InChIKey | CPZFCEFADMOJCG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |