C27H31FN2O3 — CID 137355377
3-[(13S,15R)-3-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methoxy-2-pyridinyl)propanamide (PubChem CID 137355377) has the molecular formula C27H31FN2O3 and a molecular weight of 450.55 g/mol. Its IUPAC name is 3-[(13S,15R)-3-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methoxy-2-pyridinyl)propanamide.
| Compound Name | 3-[(13S,15R)-3-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methoxy-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 137355377 |
| Molecular Formula | C27H31FN2O3 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3-[(13S,15R)-3-fluoro-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methoxy-2-pyridinyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCC2CC(=O)[C@@]3(C)CCC4c5ccc(F)cc5CCC4C23)nc1 |
| InChI | InChI=1S/C27H31FN2O3/c1-27-12-11-21-20-8-5-18(28)13-16(20)3-7-22(21)26(27)17(14-23(27)31)4-10-25(32)30-24-9-6-19(33-2)15-29-24/h5-6,8-9,13,15,17,21-22,26H,3-4,7,10-12,14H2,1-2H3,(H,29,30,32)/t17?,21?,22?,26?,27-/m1/s1 |
| InChIKey | UMSNOHHNUXEHDJ-XEBZKRNTSA-N |
| XLogP | 5.30 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |