C23H30O3 — CID 159446750
methyl 3-[(13S)-3,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoate (PubChem CID 159446750) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is methyl 3-[(13S)-3,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoate.
| Compound Name | methyl 3-[(13S)-3,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoate |
|---|---|
| PubChem CID | 159446750 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl 3-[(13S)-3,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]propanoate |
| SMILES | COC(=O)CCC1CC(=O)[C@@]2(C)CCC3c4ccc(C)cc4CCC3C12 |
| InChI | InChI=1S/C23H30O3/c1-14-4-7-17-15(12-14)5-8-19-18(17)10-11-23(2)20(24)13-16(22(19)23)6-9-21(25)26-3/h4,7,12,16,18-19,22H,5-6,8-11,13H2,1-3H3/t16?,18?,19?,22?,23-/m1/s1 |
| InChIKey | JGJCSLSCXROUMR-ZQPWAVPGSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |